C19H22N4O2 — CID 167843254
4-methyl-6-[[3-(oxolan-2-ylmethoxymethyl)phenyl]methylamino]pyrimidine-5-carbonitrile (PubChem CID 167843254) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-methyl-6-[[3-(oxolan-2-ylmethoxymethyl)phenyl]methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-methyl-6-[[3-(oxolan-2-ylmethoxymethyl)phenyl]methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 167843254 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-methyl-6-[[3-(oxolan-2-ylmethoxymethyl)phenyl]methylamino]pyrimidine-5-carbonitrile |
| SMILES | Cc1ncnc(NCc2cccc(COCC3CCCO3)c2)c1C#N |
| InChI | InChI=1S/C19H22N4O2/c1-14-18(9-20)19(23-13-22-14)21-10-15-4-2-5-16(8-15)11-24-12-17-6-3-7-25-17/h2,4-5,8,13,17H,3,6-7,10-12H2,1H3,(H,21,22,23) |
| InChIKey | XXCUYKOJMDNPIS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |