C34H47N3O4 — CID 167869618
(2-butyl-1-benzofuran-3-yl)-[4-[3-[[1-(4-methoxyphenyl)piperidin-4-yl]-methylamino]propoxy]piperidin-1-yl]methanone (PubChem CID 167869618) has the molecular formula C34H47N3O4 and a molecular weight of 561.77 g/mol. Its IUPAC name is (2-butyl-1-benzofuran-3-yl)-[4-[3-[[1-(4-methoxyphenyl)piperidin-4-yl]-methylamino]propoxy]piperidin-1-yl]methanone.
| Compound Name | (2-butyl-1-benzofuran-3-yl)-[4-[3-[[1-(4-methoxyphenyl)piperidin-4-yl]-methylamino]propoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 167869618 |
| Molecular Formula | C34H47N3O4 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | (2-butyl-1-benzofuran-3-yl)-[4-[3-[[1-(4-methoxyphenyl)piperidin-4-yl]-methylamino]propoxy]piperidin-1-yl]methanone |
| SMILES | CCCCc1oc2ccccc2c1C(=O)N1CCC(OCCCN(C)C2CCN(c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C34H47N3O4/c1-4-5-10-32-33(30-9-6-7-11-31(30)41-32)34(38)37-23-18-29(19-24-37)40-25-8-20-35(2)26-16-21-36(22-17-26)27-12-14-28(39-3)15-13-27/h6-7,9,11-15,26,29H,4-5,8,10,16-25H2,1-3H3 |
| InChIKey | XXDDPNYZBNAJDT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 58.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|