About N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide
N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide (PubChem CID 167887271) has the molecular formula C24H23N5O2S
and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide |
| PubChem CID | 167887271 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)C(=O)NC1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H23N5O2S/c30-22(23(31)29-24-28-20(14-32-24)15-6-2-1-3-7-15)25-17-12-10-16(11-13-17)21-26-18-8-4-5-9-19(18)27-21/h1-9,14,16-17H,10-13H2,(H,25,30)(H,26,27)(H,28,29,31) |
| InChIKey | LUEHIDWSVXILJA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide?
The IUPAC name of N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide (CID 167887271) is N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide.
What is the SMILES notation for N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide?
The canonical SMILES for N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide is O=C(Nc1nc(-c2ccccc2)cs1)C(=O)NC1CCC(c2nc3ccccc3[nH]2)CC1.
What is the InChIKey of N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide?
The InChIKey is LUEHIDWSVXILJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N5O2S/c30-22(23(31)29-24-28-20(14-32-24)15-6-2-1-3-7-15)25-17-12-10-16(11-13-17)21-26-18-8-4-5-9-19(18)27-21/h1-9,14,16-17H,10-13H2,(H,25,30)(H,26,27)(H,28,29,31).
What are the key properties of N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide?
N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide has a molecular weight of 445.55 g/mol, XLogP of 4.47, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide is sourced from PubChem (CID 167887271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).