C24H23N5O2S — CID 167887271
N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide (PubChem CID 167887271) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 167887271 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)cyclohexyl]-N'-(4-phenyl-1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)C(=O)NC1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H23N5O2S/c30-22(23(31)29-24-28-20(14-32-24)15-6-2-1-3-7-15)25-17-12-10-16(11-13-17)21-26-18-8-4-5-9-19(18)27-21/h1-9,14,16-17H,10-13H2,(H,25,30)(H,26,27)(H,28,29,31) |
| InChIKey | LUEHIDWSVXILJA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|