C14H12FN3O2S — CID 71889087
N-cyclopropyl-N'-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]oxamide (PubChem CID 71889087) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-cyclopropyl-N'-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]oxamide.
| Compound Name | N-cyclopropyl-N'-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]oxamide |
|---|---|
| PubChem CID | 71889087 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-cyclopropyl-N'-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]oxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2F)cs1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H12FN3O2S/c15-10-4-2-1-3-9(10)11-7-21-14(17-11)18-13(20)12(19)16-8-5-6-8/h1-4,7-8H,5-6H2,(H,16,19)(H,17,18,20) |
| InChIKey | LZJOXVKCTUBYQV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|