C24H31NO — CID 167887997
2-benzyl-N-cyclopentyl-4-methyl-N-phenylpentanamide (PubChem CID 167887997) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-benzyl-N-cyclopentyl-4-methyl-N-phenylpentanamide.
| Compound Name | 2-benzyl-N-cyclopentyl-4-methyl-N-phenylpentanamide |
|---|---|
| PubChem CID | 167887997 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-benzyl-N-cyclopentyl-4-methyl-N-phenylpentanamide |
| SMILES | CC(C)CC(Cc1ccccc1)C(=O)N(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C24H31NO/c1-19(2)17-21(18-20-11-5-3-6-12-20)24(26)25(23-15-9-10-16-23)22-13-7-4-8-14-22/h3-8,11-14,19,21,23H,9-10,15-18H2,1-2H3 |
| InChIKey | IVLGQXUGABKDIY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |