C17H18ClFN4O2 — CID 167895809
2-amino-5-chloro-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-4-fluorobenzamide (PubChem CID 167895809) has the molecular formula C17H18ClFN4O2 and a molecular weight of 364.81 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-4-fluorobenzamide.
| Compound Name | 2-amino-5-chloro-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 167895809 |
| Molecular Formula | C17H18ClFN4O2 |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-amino-5-chloro-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]-4-fluorobenzamide |
| SMILES | CN(C)C(=O)Nc1cccc(CNC(=O)c2cc(Cl)c(F)cc2N)c1 |
| InChI | InChI=1S/C17H18ClFN4O2/c1-23(2)17(25)22-11-5-3-4-10(6-11)9-21-16(24)12-7-13(18)14(19)8-15(12)20/h3-8H,9,20H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | KEHNCQXSDURBSE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|