C13H13ClN2O5S — CID 167907181
7-chloro-N-morpholin-4-ylsulfonyl-1-benzofuran-4-carboxamide (PubChem CID 167907181) has the molecular formula C13H13ClN2O5S and a molecular weight of 344.78 g/mol. Its IUPAC name is 7-chloro-N-morpholin-4-ylsulfonyl-1-benzofuran-4-carboxamide.
| Compound Name | 7-chloro-N-morpholin-4-ylsulfonyl-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 167907181 |
| Molecular Formula | C13H13ClN2O5S |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 7-chloro-N-morpholin-4-ylsulfonyl-1-benzofuran-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)N1CCOCC1)c1ccc(Cl)c2occc12 |
| InChI | InChI=1S/C13H13ClN2O5S/c14-11-2-1-10(9-3-6-21-12(9)11)13(17)15-22(18,19)16-4-7-20-8-5-16/h1-3,6H,4-5,7-8H2,(H,15,17) |
| InChIKey | RNJLBTVBVYRDET-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |