C18H19FN4O2 — CID 167927699
(3aR,6aS)-N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 167927699) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is (3aR,6aS)-N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 167927699 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (3aR,6aS)-N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1ccc(-n2ccccc2=O)cc1F)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C18H19FN4O2/c19-15-7-14(23-6-2-1-3-17(23)24)4-5-16(15)21-18(25)22-10-12-8-20-9-13(12)11-22/h1-7,12-13,20H,8-11H2,(H,21,25)/t12-,13+ |
| InChIKey | NYANINSMJQIEEP-BETUJISGSA-N |
| XLogP | 1.66 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |