C16H19ClN2O3 — CID 167985666
5-(3-chlorophenyl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-5-methylimidazolidine-2,4-dione (PubChem CID 167985666) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(3-chlorophenyl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167985666 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 5-(3-chlorophenyl)-3-[(E)-4-methoxy-3-methylbut-2-enyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COC/C(C)=C/CN1C(=O)NC(C)(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C16H19ClN2O3/c1-11(10-22-3)7-8-19-14(20)16(2,18-15(19)21)12-5-4-6-13(17)9-12/h4-7,9H,8,10H2,1-3H3,(H,18,21)/b11-7+ |
| InChIKey | IXGLPCCSSFIOGR-YRNVUSSQSA-N |
| XLogP | 2.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|