C18H18F3N4O2+ — CID 167998551
6-ethyl-1,3-dimethyl-5-[3-(trifluoromethyl)phenyl]imino-4aH-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione (PubChem CID 167998551) has the molecular formula C18H18F3N4O2+ and a molecular weight of 379.36 g/mol. Its IUPAC name is 6-ethyl-1,3-dimethyl-5-[3-(trifluoromethyl)phenyl]imino-4aH-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione.
| Compound Name | 6-ethyl-1,3-dimethyl-5-[3-(trifluoromethyl)phenyl]imino-4aH-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
|---|---|
| PubChem CID | 167998551 |
| Molecular Formula | C18H18F3N4O2+ |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-ethyl-1,3-dimethyl-5-[3-(trifluoromethyl)phenyl]imino-4aH-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
| SMILES | CCC1=C[NH+]=C2C(C(=O)N(C)C(=O)N2C)/C1=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N4O2/c1-4-10-9-22-15-13(16(26)25(3)17(27)24(15)2)14(10)23-12-7-5-6-11(8-12)18(19,20)21/h5-9,13H,4H2,1-3H3/p+1/b23-14+ |
| InChIKey | CTXMYAKFLKATKZ-OEAKJJBVSA-O |
| XLogP | 1.70 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|