C17H20N4O2S — CID 16844563
1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-5-propan-2-ylpyrazole-3-carboxamide (PubChem CID 16844563) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-5-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-5-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 16844563 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-5-propan-2-ylpyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1cc(C(C)C)n(-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11(2)14-10-13(16(22)18-8-9-23-3)20-21(14)17-19-12-6-4-5-7-15(12)24-17/h4-7,10-11H,8-9H2,1-3H3,(H,18,22) |
| InChIKey | HPEFHQZSBBJJDB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|