C17H13NO2S2 — CID 168516264
2-[3-(1,3-dithiolan-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 168516264) has the molecular formula C17H13NO2S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[3-(1,3-dithiolan-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dithiolan-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516264 |
| Molecular Formula | C17H13NO2S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-[3-(1,3-dithiolan-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C17H13NO2S2/c19-15-13-6-1-2-7-14(13)16(20)18(15)12-5-3-4-11(10-12)17-21-8-9-22-17/h1-7,10,17H,8-9H2 |
| InChIKey | UTKLYLPYCKKADU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|