C17H12BrNO4 — CID 168517947
2-[3-bromo-5-(1,3-dioxolan-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 168517947) has the molecular formula C17H12BrNO4 and a molecular weight of 374.19 g/mol. Its IUPAC name is 2-[3-bromo-5-(1,3-dioxolan-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-bromo-5-(1,3-dioxolan-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517947 |
| Molecular Formula | C17H12BrNO4 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2-[3-bromo-5-(1,3-dioxolan-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(Br)cc(C2OCCO2)c1 |
| InChI | InChI=1S/C17H12BrNO4/c18-11-7-10(17-22-5-6-23-17)8-12(9-11)19-15(20)13-3-1-2-4-14(13)16(19)21/h1-4,7-9,17H,5-6H2 |
| InChIKey | CKMVQYMOKVBJIV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|