C19H15NO4 — CID 168526840
2-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]furan (PubChem CID 168526840) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]furan.
| Compound Name | 2-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]furan |
|---|---|
| PubChem CID | 168526840 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]furan |
| SMILES | O=[N+]([O-])c1cc(Oc2ccc3c(c2)CCC3)cc(-c2ccco2)c1 |
| InChI | InChI=1S/C19H15NO4/c21-20(22)16-9-15(19-5-2-8-23-19)11-18(12-16)24-17-7-6-13-3-1-4-14(13)10-17/h2,5-12H,1,3-4H2 |
| InChIKey | NJNIUPQGNAMOHZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|