C14H12FN3O4 — CID 168557409
3-[(6-fluoro-3-methyl-1,2-benzoxazol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557409) has the molecular formula C14H12FN3O4 and a molecular weight of 305.27 g/mol. Its IUPAC name is 3-[(6-fluoro-3-methyl-1,2-benzoxazol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[(6-fluoro-3-methyl-1,2-benzoxazol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557409 |
| Molecular Formula | C14H12FN3O4 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[(6-fluoro-3-methyl-1,2-benzoxazol-5-yl)amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | Cc1noc2cc(F)c(NC3=CC(=O)N(CCO)C3=O)cc12 |
| InChI | InChI=1S/C14H12FN3O4/c1-7-8-4-10(9(15)5-12(8)22-17-7)16-11-6-13(20)18(2-3-19)14(11)21/h4-6,16,19H,2-3H2,1H3 |
| InChIKey | SIYSSDFTCHUAHH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|