C17H16N2O4S — CID 168559299
1-(2-hydroxyethyl)-3-[4-(thiophen-2-ylmethoxy)anilino]pyrrole-2,5-dione (PubChem CID 168559299) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-(thiophen-2-ylmethoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-(thiophen-2-ylmethoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559299 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-(thiophen-2-ylmethoxy)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(OCc3cccs3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C17H16N2O4S/c20-8-7-19-16(21)10-15(17(19)22)18-12-3-5-13(6-4-12)23-11-14-2-1-9-24-14/h1-6,9-10,18,20H,7-8,11H2 |
| InChIKey | BEDUUTRZNUJPHZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|