C18H18BrN3O4S — CID 168589419
4-[5-bromo-2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589419) has the molecular formula C18H18BrN3O4S and a molecular weight of 452.33 g/mol. Its IUPAC name is 4-[5-bromo-2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[5-bromo-2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589419 |
| Molecular Formula | C18H18BrN3O4S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 4-[5-bromo-2-[2-(1,3-dioxan-2-yl)ethoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(Br)ccc2OCCC2OCCCO2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C18H18BrN3O4S/c1-27-18-21-16(13(10-20)17(23)22-18)12-9-11(19)3-4-14(12)24-8-5-15-25-6-2-7-26-15/h3-4,9,15H,2,5-8H2,1H3,(H,21,22,23) |
| InChIKey | TTYMNNVJZGPZTG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|