C11H18N2O4S — CID 168596769
2-(2,3-dihydroxypropylamino)-3,5-dimethylbenzenesulfonamide (PubChem CID 168596769) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-3,5-dimethylbenzenesulfonamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 168596769 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(NCC(O)CO)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N2O4S/c1-7-3-8(2)11(13-5-9(15)6-14)10(4-7)18(12,16)17/h3-4,9,13-15H,5-6H2,1-2H3,(H2,12,16,17) |
| InChIKey | OQBJITCJCQLNET-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |