C16H15FN4O — CID 168609538
2-[2-(2,2-dimethylpropoxy)-6-fluoroanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609538) has the molecular formula C16H15FN4O and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropoxy)-6-fluoroanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2-(2,2-dimethylpropoxy)-6-fluoroanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609538 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[2-(2,2-dimethylpropoxy)-6-fluoroanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC(C)(C)COc1cccc(F)c1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C16H15FN4O/c1-16(2,3)10-22-14-6-4-5-12(17)15(14)21-13(9-20)11(7-18)8-19/h4-6,21H,10H2,1-3H3 |
| InChIKey | QAFBQFOWDLJKLV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|