C21H25ClN4O3S — CID 168612821
tert-butyl N-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-4-chloro-5-methoxyphenyl]carbamate (PubChem CID 168612821) has the molecular formula C21H25ClN4O3S and a molecular weight of 448.98 g/mol. Its IUPAC name is tert-butyl N-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-4-chloro-5-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-4-chloro-5-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 168612821 |
| Molecular Formula | C21H25ClN4O3S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | tert-butyl N-[2-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-4-chloro-5-methoxyphenyl]carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)c(C=NN=C(N)SCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H25ClN4O3S/c1-21(2,3)29-20(27)25-17-11-18(28-4)16(22)10-15(17)12-24-26-19(23)30-13-14-8-6-5-7-9-14/h5-12H,13H2,1-4H3,(H2,23,26)(H,25,27) |
| InChIKey | ZQMRBQCABCNXIB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|