C22H20ClN3O2S2 — CID 168612225
benzyl N'-[[2-chloro-6-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]methylideneamino]carbamimidothioate (PubChem CID 168612225) has the molecular formula C22H20ClN3O2S2 and a molecular weight of 458.01 g/mol. Its IUPAC name is benzyl N'-[[2-chloro-6-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2-chloro-6-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612225 |
| Molecular Formula | C22H20ClN3O2S2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | benzyl N'-[[2-chloro-6-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccccc1Sc1cc(O)c(C=NN=C(N)SCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H20ClN3O2S2/c1-28-20-9-5-6-10-21(20)30-16-11-18(23)17(19(27)12-16)13-25-26-22(24)29-14-15-7-3-2-4-8-15/h2-13,27H,14H2,1H3,(H2,24,26) |
| InChIKey | OODPEXXUYZSRKY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|