About dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate
dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate (PubChem CID 168647539) has the molecular formula C17H12ClFN2O4
and a molecular weight of 362.74 g/mol. Its IUPAC name is dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate |
| PubChem CID | 168647539 |
| Molecular Formula | C17H12ClFN2O4 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Cl)c(F)c2C#N)C=CC=C1 |
| InChI | InChI=1S/C17H12ClFN2O4/c1-24-16(22)10-5-3-4-8-21(15(10)17(23)25-2)13-7-6-12(18)14(19)11(13)9-20/h3-8H,1-2H3 |
| InChIKey | VXMWKLZJUQFEPO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate (CID 168647539) is dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)N(c2ccc(Cl)c(F)c2C#N)C=CC=C1.
What is the InChIKey of dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate?
The InChIKey is VXMWKLZJUQFEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClFN2O4/c1-24-16(22)10-5-3-4-8-21(15(10)17(23)25-2)13-7-6-12(18)14(19)11(13)9-20/h3-8H,1-2H3.
What are the key properties of dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate?
dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate has a molecular weight of 362.74 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(4-chloro-2-cyano-3-fluorophenyl)azepine-2,3-dicarboxylate is sourced from PubChem (CID 168647539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).