C19H13F5N2O4S — CID 168647342
dimethyl 1-[2-cyano-3-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168647342) has the molecular formula C19H13F5N2O4S and a molecular weight of 460.38 g/mol. Its IUPAC name is dimethyl 1-[2-cyano-3-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-cyano-3-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647342 |
| Molecular Formula | C19H13F5N2O4S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | dimethyl 1-[2-cyano-3-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(SC(F)(F)C(F)(F)F)c2C#N)C=CC=C1 |
| InChI | InChI=1S/C19H13F5N2O4S/c1-29-16(27)11-6-3-4-9-26(15(11)17(28)30-2)13-7-5-8-14(12(13)10-25)31-19(23,24)18(20,21)22/h3-9H,1-2H3 |
| InChIKey | COZRJXJPHHIUBL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|