C12H19N2O5S- — CID 168787181
(4S)-5-[[(2R)-1-acetylsulfanyl-3-oxobutan-2-yl]amino]-4-(methylamino)-5-oxopentanoate (PubChem CID 168787181) has the molecular formula C12H19N2O5S- and a molecular weight of 303.36 g/mol. Its IUPAC name is (4S)-5-[[(2R)-1-acetylsulfanyl-3-oxobutan-2-yl]amino]-4-(methylamino)-5-oxopentanoate.
| Compound Name | (4S)-5-[[(2R)-1-acetylsulfanyl-3-oxobutan-2-yl]amino]-4-(methylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 168787181 |
| Molecular Formula | C12H19N2O5S- |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (4S)-5-[[(2R)-1-acetylsulfanyl-3-oxobutan-2-yl]amino]-4-(methylamino)-5-oxopentanoate |
| SMILES | CN[C@@H](CCC(=O)[O-])C(=O)N[C@@H](CSC(C)=O)C(C)=O |
| InChI | InChI=1S/C12H20N2O5S/c1-7(15)10(6-20-8(2)16)14-12(19)9(13-3)4-5-11(17)18/h9-10,13H,4-6H2,1-3H3,(H,14,19)(H,17,18)/p-1/t9-,10-/m0/s1 |
| InChIKey | AOTFJWRGFJZXDM-UWVGGRQHSA-M |
| XLogP | -1.54 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|