C32H36O3 — CID 168810766
3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-2,4,5,7,9,10-hexahydroanthracene-1,8-dione (PubChem CID 168810766) has the molecular formula C32H36O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-2,4,5,7,9,10-hexahydroanthracene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-2,4,5,7,9,10-hexahydroanthracene-1,8-dione |
|---|---|
| PubChem CID | 168810766 |
| Molecular Formula | C32H36O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-2,4,5,7,9,10-hexahydroanthracene-1,8-dione |
| SMILES | Cc1ccccc1COc1ccc(C2C3=C(CC4=C2C(=O)CC(C)(C)C4)CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C32H36O3/c1-20-8-6-7-9-22(20)19-35-25-12-10-21(11-13-25)30-28-23(15-31(2,3)17-26(28)33)14-24-16-32(4,5)18-27(34)29(24)30/h6-13,30H,14-19H2,1-5H3 |
| InChIKey | LNPRLCUPSLHQHB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |