C31H27N4OPtTe-3 — CID 168840657
10-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-phenotellurazin-1-ide;platinum (PubChem CID 168840657) has the molecular formula C31H27N4OPtTe-3 and a molecular weight of 794.26 g/mol. Its IUPAC name is 10-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-phenotellurazin-1-ide;platinum.
| Compound Name | 10-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-phenotellurazin-1-ide;platinum |
|---|---|
| PubChem CID | 168840657 |
| Molecular Formula | C31H27N4OPtTe-3 |
| Molecular Weight | 794.26 g/mol |
| Exact Mass | 796.09 |
| IUPAC Name | 10-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-phenotellurazin-1-ide;platinum |
| SMILES | CN1C=CN(c2[c-]c(Oc3[c-]c4c(cc3)[Te]c3ccccc3N4c3cc(C(C)(C)C)ccn3)ccc2)[CH-]1.[Pt] |
| InChI | InChI=1S/C31H27N4OTe.Pt/c1-31(2,3)22-14-15-32-30(18-22)35-26-10-5-6-11-28(26)37-29-13-12-25(20-27(29)35)36-24-9-7-8-23(19-24)34-17-16-33(4)21-34;/h5-18,21H,1-4H3;/q-3; |
| InChIKey | NEWCJFRDZMZYJU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.26 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|