C15H17N3O3 — CID 168870040
(5Z)-5-[(4-piperidin-4-yloxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 168870040) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (5Z)-5-[(4-piperidin-4-yloxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-piperidin-4-yloxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 168870040 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (5Z)-5-[(4-piperidin-4-yloxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OC3CCNCC3)cc2)N1 |
| InChI | InChI=1S/C15H17N3O3/c19-14-13(17-15(20)18-14)9-10-1-3-11(4-2-10)21-12-5-7-16-8-6-12/h1-4,9,12,16H,5-8H2,(H2,17,18,19,20)/b13-9- |
| InChIKey | QPYPIBIZLDVHDJ-LCYFTJDESA-N |
| XLogP | 1.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|