C20H23N3O3S — CID 168886780
1-[[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]sulfanylamino]propan-2-ol (PubChem CID 168886780) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]sulfanylamino]propan-2-ol.
| Compound Name | 1-[[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]sulfanylamino]propan-2-ol |
|---|---|
| PubChem CID | 168886780 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]sulfanylamino]propan-2-ol |
| SMILES | COc1cc2nccc(Nc3ccc(SNCC(C)O)cc3)c2cc1OC |
| InChI | InChI=1S/C20H23N3O3S/c1-13(24)12-22-27-15-6-4-14(5-7-15)23-17-8-9-21-18-11-20(26-3)19(25-2)10-16(17)18/h4-11,13,22,24H,12H2,1-3H3,(H,21,23) |
| InChIKey | HQJIAZUPHFBDGO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|