C26H20N2O4S — CID 168893555
N-(4-aminophenyl)-2-hydroxy-5-[5-[(Z)-(3-hydroxy-3H-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzamide (PubChem CID 168893555) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-hydroxy-5-[5-[(Z)-(3-hydroxy-3H-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzamide.
| Compound Name | N-(4-aminophenyl)-2-hydroxy-5-[5-[(Z)-(3-hydroxy-3H-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 168893555 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-(4-aminophenyl)-2-hydroxy-5-[5-[(Z)-(3-hydroxy-3H-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzamide |
| SMILES | Nc1ccc(NC(=O)c2cc(-c3ccc(/C=C4\Sc5ccccc5C4O)o3)ccc2O)cc1 |
| InChI | InChI=1S/C26H20N2O4S/c27-16-6-8-17(9-7-16)28-26(31)20-13-15(5-11-21(20)29)22-12-10-18(32-22)14-24-25(30)19-3-1-2-4-23(19)33-24/h1-14,25,29-30H,27H2,(H,28,31)/b24-14- |
| InChIKey | FCEAQTNADNUGKC-OYKKKHCWSA-N |
| XLogP | 5.67 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|