C19H27N5O3S — CID 168894591
(1R,4R,5S)-4-(6-amino-2-heptylsulfanylpurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hex-2-ene-2,3-diol (PubChem CID 168894591) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is (1R,4R,5S)-4-(6-amino-2-heptylsulfanylpurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hex-2-ene-2,3-diol.
| Compound Name | (1R,4R,5S)-4-(6-amino-2-heptylsulfanylpurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hex-2-ene-2,3-diol |
|---|---|
| PubChem CID | 168894591 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (1R,4R,5S)-4-(6-amino-2-heptylsulfanylpurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hex-2-ene-2,3-diol |
| SMILES | CCCCCCCSc1nc(N)c2ncn([C@H]3C(O)=C(O)[C@]4(CO)C[C@H]34)c2n1 |
| InChI | InChI=1S/C19H27N5O3S/c1-2-3-4-5-6-7-28-18-22-16(20)12-17(23-18)24(10-21-12)13-11-8-19(11,9-25)15(27)14(13)26/h10-11,13,25-27H,2-9H2,1H3,(H2,20,22,23)/t11-,13-,19+/m1/s1 |
| InChIKey | SYRNEFPWSPOQFY-MVBJNABHSA-N |
| XLogP | 3.35 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|