C20H29FNO — CID 168906029
CID 168906029 (PubChem CID 168906029) has the molecular formula C20H29FNO and a molecular weight of 318.46 g/mol.
| Compound Name | CID 168906029 |
|---|---|
| PubChem CID | 168906029 |
| Molecular Formula | C20H29FNO |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | — |
| SMILES | [CH2]C/C(=C/C=C)C(=C(C)C)/C(=N/C)C(CC)CCC(=O)C(=C)F |
| InChI | InChI=1S/C20H29FNO/c1-8-11-16(9-2)19(14(4)5)20(22-7)17(10-3)12-13-18(23)15(6)21/h8,11,17H,1-2,6,9-10,12-13H2,3-5,7H3/b16-11-,22-20+ |
| InChIKey | NVQIWJLPUPPVCW-FTPGLHQHSA-N |
| XLogP | 5.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|