C34H47F3N4O4 — CID 168906367
tert-butyl 3-[2-[4-(1,1-difluoroethoxy)anilino]-3-(2-ethylbutanimidoyl)-4-pyridinyl]azetidine-1-carboxylate;2-fluoro-4-methylhex-1-en-3-one (PubChem CID 168906367) has the molecular formula C34H47F3N4O4 and a molecular weight of 632.77 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-(1,1-difluoroethoxy)anilino]-3-(2-ethylbutanimidoyl)-4-pyridinyl]azetidine-1-carboxylate;2-fluoro-4-methylhex-1-en-3-one.
| Compound Name | tert-butyl 3-[2-[4-(1,1-difluoroethoxy)anilino]-3-(2-ethylbutanimidoyl)-4-pyridinyl]azetidine-1-carboxylate;2-fluoro-4-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 168906367 |
| Molecular Formula | C34H47F3N4O4 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | tert-butyl 3-[2-[4-(1,1-difluoroethoxy)anilino]-3-(2-ethylbutanimidoyl)-4-pyridinyl]azetidine-1-carboxylate;2-fluoro-4-methylhex-1-en-3-one |
| SMILES | C=C(F)C(=O)C(C)CC.[H]/N=C(/c1c(C2CN(C(=O)OC(C)(C)C)C2)ccnc1Nc1ccc(OC(C)(F)F)cc1)C(CC)CC |
| InChI | InChI=1S/C27H36F2N4O3.C7H11FO/c1-7-17(8-2)23(30)22-21(18-15-33(16-18)25(34)36-26(3,4)5)13-14-31-24(22)32-19-9-11-20(12-10-19)35-27(6,28)29;1-4-5(2)7(9)6(3)8/h9-14,17-18,30H,7-8,15-16H2,1-6H3,(H,31,32);5H,3-4H2,1-2H3/b30-23+; |
| InChIKey | QPPFZVVXXCKPQA-LMRTZVMQSA-N |
| XLogP | 9.04 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|