C23H26ClF3N4O2 — CID 168906025
tert-butyl 3-[2-[2-chloro-4-(trifluoromethyl)anilino]-4-ethylpyridine-3-carboximidoyl]azetidine-1-carboxylate (PubChem CID 168906025) has the molecular formula C23H26ClF3N4O2 and a molecular weight of 482.93 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-chloro-4-(trifluoromethyl)anilino]-4-ethylpyridine-3-carboximidoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-chloro-4-(trifluoromethyl)anilino]-4-ethylpyridine-3-carboximidoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168906025 |
| Molecular Formula | C23H26ClF3N4O2 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | tert-butyl 3-[2-[2-chloro-4-(trifluoromethyl)anilino]-4-ethylpyridine-3-carboximidoyl]azetidine-1-carboxylate |
| SMILES | [H]/N=C(/c1c(CC)ccnc1Nc1ccc(C(F)(F)F)cc1Cl)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H26ClF3N4O2/c1-5-13-8-9-29-20(30-17-7-6-15(10-16(17)24)23(25,26)27)18(13)19(28)14-11-31(12-14)21(32)33-22(2,3)4/h6-10,14,28H,5,11-12H2,1-4H3,(H,29,30)/b28-19+ |
| InChIKey | XKFUEKZDBKXRKL-TURZUDJPSA-N |
| XLogP | 6.29 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|