C23H25F2N4O2PU — CID 168906219
tert-butyl 3-[2-(anilino)-4-ethynylpyridine-3-carboximidoyl]azetidine-1-carboxylate;difluoromethylphosphane;uranium(2+) (PubChem CID 168906219) has the molecular formula C23H25F2N4O2PU and a molecular weight of 696.48 g/mol. Its IUPAC name is tert-butyl 3-[2-(anilino)-4-ethynylpyridine-3-carboximidoyl]azetidine-1-carboxylate;difluoromethylphosphane;uranium(2+).
| Compound Name | tert-butyl 3-[2-(anilino)-4-ethynylpyridine-3-carboximidoyl]azetidine-1-carboxylate;difluoromethylphosphane;uranium(2+) |
|---|---|
| PubChem CID | 168906219 |
| Molecular Formula | C23H25F2N4O2PU |
| Molecular Weight | 696.48 g/mol |
| Exact Mass | 696.22 |
| IUPAC Name | tert-butyl 3-[2-(anilino)-4-ethynylpyridine-3-carboximidoyl]azetidine-1-carboxylate;difluoromethylphosphane;uranium(2+) |
| SMILES | F[C-](F)P.[H]/N=C(/c1c(C#C)ccnc1Nc1cc[c-]cc1)C1CN(C(=O)OC(C)(C)C)C1.[U+2] |
| InChI | InChI=1S/C22H23N4O2.CH2F2P.U/c1-5-15-11-12-24-20(25-17-9-7-6-8-10-17)18(15)19(23)16-13-26(14-16)21(27)28-22(2,3)4;2-1(3)4;/h1,7-12,16,23H,13-14H2,2-4H3,(H,24,25);4H2;/q2*-1;+2/b23-19+;; |
| InChIKey | OMFVOQRJNPPJOJ-GHEHHKQRSA-N |
| XLogP | 5.09 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|