C21H28ClN5O2 — CID 168910390
(4Z,6R)-4-[amino-[4-chloro-6-(1,4-diazepan-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 168910390) has the molecular formula C21H28ClN5O2 and a molecular weight of 417.94 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-chloro-6-(1,4-diazepan-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-chloro-6-(1,4-diazepan-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 168910390 |
| Molecular Formula | C21H28ClN5O2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-chloro-6-(1,4-diazepan-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | N/C(=C1/CCC[C@@]2(CCCCC2=O)C1=O)c1nc(Cl)cc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C21H28ClN5O2/c22-16-13-17(27-11-4-9-24-10-12-27)26-20(25-16)18(23)14-5-3-8-21(19(14)29)7-2-1-6-15(21)28/h13,24H,1-12,23H2/b18-14-/t21-/m1/s1 |
| InChIKey | VIXXTVMEKBBPBW-JOIYNNFJSA-N |
| XLogP | 2.48 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|