C32H41N7O6 — CID 168932471
(E)-2-[(2,3-dimethylimidazole-4-carbonyl)amino]-N'-ethyl-N-[1-[2-[(3-methyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-oxohex-2-enediamide (PubChem CID 168932471) has the molecular formula C32H41N7O6 and a molecular weight of 619.72 g/mol. Its IUPAC name is (E)-2-[(2,3-dimethylimidazole-4-carbonyl)amino]-N'-ethyl-N-[1-[2-[(3-methyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-oxohex-2-enediamide.
| Compound Name | (E)-2-[(2,3-dimethylimidazole-4-carbonyl)amino]-N'-ethyl-N-[1-[2-[(3-methyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-oxohex-2-enediamide |
|---|---|
| PubChem CID | 168932471 |
| Molecular Formula | C32H41N7O6 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | (E)-2-[(2,3-dimethylimidazole-4-carbonyl)amino]-N'-ethyl-N-[1-[2-[(3-methyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-oxohex-2-enediamide |
| SMILES | CCNC(=O)C(=O)C/C=C(/NC(=O)c1cnc(C)n1C)C(=O)Nc1cccn(CC(=O)NC23CC4CC(CC(C)(C4)C2)C3)c1=O |
| InChI | InChI=1S/C32H41N7O6/c1-5-33-29(44)25(40)9-8-22(35-28(43)24-16-34-19(2)38(24)4)27(42)36-23-7-6-10-39(30(23)45)17-26(41)37-32-14-20-11-21(15-32)13-31(3,12-20)18-32/h6-8,10,16,20-21H,5,9,11-15,17-18H2,1-4H3,(H,33,44)(H,35,43)(H,36,42)(H,37,41)/b22-8+ |
| InChIKey | MNMGOXRWUBFZMQ-GZIVZEMBSA-N |
| XLogP | 1.71 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|