C35H49N7O6 — CID 166455272
(2S)-N'-ethyl-N-[1-[2-[(3-ethyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[1-(2-methylpropyl)imidazole-4-carbonyl]amino]-5-oxohexanediamide (PubChem CID 166455272) has the molecular formula C35H49N7O6 and a molecular weight of 663.82 g/mol. Its IUPAC name is (2S)-N'-ethyl-N-[1-[2-[(3-ethyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[1-(2-methylpropyl)imidazole-4-carbonyl]amino]-5-oxohexanediamide.
| Compound Name | (2S)-N'-ethyl-N-[1-[2-[(3-ethyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[1-(2-methylpropyl)imidazole-4-carbonyl]amino]-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455272 |
| Molecular Formula | C35H49N7O6 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | (2S)-N'-ethyl-N-[1-[2-[(3-ethyl-1-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-[[1-(2-methylpropyl)imidazole-4-carbonyl]amino]-5-oxohexanediamide |
| SMILES | CCNC(=O)C(=O)CC[C@H](NC(=O)c1cn(CC(C)C)cn1)C(=O)Nc1cccn(CC(=O)NC23CC4CC(CC(CC)(C4)C2)C3)c1=O |
| InChI | InChI=1S/C35H49N7O6/c1-5-34-13-23-12-24(14-34)16-35(15-23,20-34)40-29(44)19-42-11-7-8-26(33(42)48)39-30(45)25(9-10-28(43)32(47)36-6-2)38-31(46)27-18-41(21-37-27)17-22(3)4/h7-8,11,18,21-25H,5-6,9-10,12-17,19-20H2,1-4H3,(H,36,47)(H,38,46)(H,39,45)(H,40,44)/t23?,24?,25-,34?,35?/m0/s1 |
| InChIKey | NRXYXLNGARKACD-FDHQRVKQSA-N |
| XLogP | 2.79 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|