C31H46N6O7 — CID 167291386
(5S)-N-ethyl-2-hydroxy-N'-[1-[2-[(5-methyl-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-[[(3R)-morpholine-3-carbonyl]amino]hexanediamide (PubChem CID 167291386) has the molecular formula C31H46N6O7 and a molecular weight of 614.74 g/mol. Its IUPAC name is (5S)-N-ethyl-2-hydroxy-N'-[1-[2-[(5-methyl-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-[[(3R)-morpholine-3-carbonyl]amino]hexanediamide.
| Compound Name | (5S)-N-ethyl-2-hydroxy-N'-[1-[2-[(5-methyl-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-[[(3R)-morpholine-3-carbonyl]amino]hexanediamide |
|---|---|
| PubChem CID | 167291386 |
| Molecular Formula | C31H46N6O7 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | (5S)-N-ethyl-2-hydroxy-N'-[1-[2-[(5-methyl-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-5-[[(3R)-morpholine-3-carbonyl]amino]hexanediamide |
| SMILES | CCNC(=O)C(O)CC[C@H](NC(=O)[C@H]1COCCN1)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC2CC(C)(C4)C3)c1=O |
| InChI | InChI=1S/C31H46N6O7/c1-3-32-29(42)24(38)7-6-21(34-28(41)23-17-44-10-8-33-23)27(40)35-22-5-4-9-37(30(22)43)16-25(39)36-26-19-11-18-12-20(26)15-31(2,13-18)14-19/h4-5,9,18-21,23-24,26,33,38H,3,6-8,10-17H2,1-2H3,(H,32,42)(H,34,41)(H,35,40)(H,36,39)/t18?,19?,20?,21-,23+,24?,26?,31?/m0/s1 |
| InChIKey | MRDJQGWLCKRHPJ-CARWBJKRSA-N |
| XLogP | -0.13 |
| TPSA | 179.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |