C17H27BrN2O5 — CID 168944719
[2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]-[2-(1,3-oxazinan-3-yl)ethoxy]methanol (PubChem CID 168944719) has the molecular formula C17H27BrN2O5 and a molecular weight of 419.32 g/mol. Its IUPAC name is [2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]-[2-(1,3-oxazinan-3-yl)ethoxy]methanol.
| Compound Name | [2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]-[2-(1,3-oxazinan-3-yl)ethoxy]methanol |
|---|---|
| PubChem CID | 168944719 |
| Molecular Formula | C17H27BrN2O5 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [2-(4-bromo-2,5-dimethoxyphenyl)ethylamino]-[2-(1,3-oxazinan-3-yl)ethoxy]methanol |
| SMILES | COc1cc(CCNC(O)OCCN2CCCOC2)c(OC)cc1Br |
| InChI | InChI=1S/C17H27BrN2O5/c1-22-15-11-14(18)16(23-2)10-13(15)4-5-19-17(21)25-9-7-20-6-3-8-24-12-20/h10-11,17,19,21H,3-9,12H2,1-2H3 |
| InChIKey | WMGFNGLHIWQDLY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|