C18H22BrNO5 — CID 168944742
ethyl 2-[2-(4-bromo-2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]cyclopentene-1-carboxylate (PubChem CID 168944742) has the molecular formula C18H22BrNO5 and a molecular weight of 412.28 g/mol. Its IUPAC name is ethyl 2-[2-(4-bromo-2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]cyclopentene-1-carboxylate.
| Compound Name | ethyl 2-[2-(4-bromo-2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 168944742 |
| Molecular Formula | C18H22BrNO5 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | ethyl 2-[2-(4-bromo-2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]cyclopentene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)NCCc2cc(OC)c(Br)cc2O)CCC1 |
| InChI | InChI=1S/C18H22BrNO5/c1-3-25-18(23)13-6-4-5-12(13)17(22)20-8-7-11-9-16(24-2)14(19)10-15(11)21/h9-10,21H,3-8H2,1-2H3,(H,20,22) |
| InChIKey | RDXSDUXBDUFATJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |