About 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+)
6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) (PubChem CID 168949023) has the molecular formula C12H22NRb
and a molecular weight of 265.78 g/mol. Its IUPAC name is 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+).
Molecular Properties
| Compound Name | 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) |
| PubChem CID | 168949023 |
| Molecular Formula | C12H22NRb |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) |
| SMILES | C[C-](C)C1CC2(CCCN(C)C2)C1.[Rb+] |
| InChI | InChI=1S/C12H22N.Rb/c1-10(2)11-7-12(8-11)5-4-6-13(3)9-12;/h11H,4-9H2,1-3H3;/q-1;+1 |
| InChIKey | QFOLFCIHTHSIBP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+)?
The IUPAC name of 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) (CID 168949023) is 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+).
What is the SMILES notation for 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+)?
The canonical SMILES for 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) is C[C-](C)C1CC2(CCCN(C)C2)C1.[Rb+].
What is the InChIKey of 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+)?
The InChIKey is QFOLFCIHTHSIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N.Rb/c1-10(2)11-7-12(8-11)5-4-6-13(3)9-12;/h11H,4-9H2,1-3H3;/q-1;+1.
What are the key properties of 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+)?
6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) has a molecular weight of 265.78 g/mol, XLogP of -0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propan-2-yl-6-azaspiro[3.5]nonane;rubidium(1+) is sourced from PubChem (CID 168949023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).