C23H29F2N5O — CID 168959293
N-[2-[4-[2-(butylamino)ethylamino]phenyl]ethyl]-1-(difluoromethyl)pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 168959293) has the molecular formula C23H29F2N5O and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-[4-[2-(butylamino)ethylamino]phenyl]ethyl]-1-(difluoromethyl)pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-[2-[4-[2-(butylamino)ethylamino]phenyl]ethyl]-1-(difluoromethyl)pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 168959293 |
| Molecular Formula | C23H29F2N5O |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[2-[4-[2-(butylamino)ethylamino]phenyl]ethyl]-1-(difluoromethyl)pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | CCCCNCCNc1ccc(CCNC(=O)c2cnc3c(ccn3C(F)F)c2)cc1 |
| InChI | InChI=1S/C23H29F2N5O/c1-2-3-10-26-12-13-27-20-6-4-17(5-7-20)8-11-28-22(31)19-15-18-9-14-30(23(24)25)21(18)29-16-19/h4-7,9,14-16,23,26-27H,2-3,8,10-13H2,1H3,(H,28,31) |
| InChIKey | XPRMCKCLXSBXFK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|