C54H100N2 — CID 168962291
3,5-dimethyl-3-pentan-3-ylcyclopentene;N-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-enyl]-8-methylidene-N-non-8-enyl-12-pentylheptadecan-1-amine (PubChem CID 168962291) has the molecular formula C54H100N2 and a molecular weight of 777.41 g/mol. Its IUPAC name is 3,5-dimethyl-3-pentan-3-ylcyclopentene;N-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-enyl]-8-methylidene-N-non-8-enyl-12-pentylheptadecan-1-amine.
| Compound Name | 3,5-dimethyl-3-pentan-3-ylcyclopentene;N-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-enyl]-8-methylidene-N-non-8-enyl-12-pentylheptadecan-1-amine |
|---|---|
| PubChem CID | 168962291 |
| Molecular Formula | C54H100N2 |
| Molecular Weight | 777.41 g/mol |
| Exact Mass | 776.79 |
| IUPAC Name | 3,5-dimethyl-3-pentan-3-ylcyclopentene;N-[(Z)-5-(ethylideneamino)-4-methylidenehept-5-enyl]-8-methylidene-N-non-8-enyl-12-pentylheptadecan-1-amine |
| SMILES | C=CCCCCCCCN(CCCCCCCC(=C)CCCC(CCCCC)CCCCC)CCCC(=C)C(=C/C)/N=C/C.CCC(CC)C1(C)C=CC(C)C1 |
| InChI | InChI=1S/C42H78N2.C12H22/c1-8-13-16-17-18-21-26-36-44(38-29-32-40(7)42(11-4)43-12-5)37-27-22-19-20-25-30-39(6)31-28-35-41(33-23-14-9-2)34-24-15-10-3;1-5-11(6-2)12(4)8-7-10(3)9-12/h8,11-12,41H,1,6-7,9-10,13-38H2,2-5H3;7-8,10-11H,5-6,9H2,1-4H3/b42-11-,43-12+; |
| InChIKey | QTZDEKUPXNVZCH-MXYZUDNYSA-N |
| XLogP | 18.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.41 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|