C18H10F3N3O2 — CID 168970717
(E)-2-cyano-3-[1-[2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 168970717) has the molecular formula C18H10F3N3O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[1-[2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 168970717 |
| Molecular Formula | C18H10F3N3O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (E)-2-cyano-3-[1-[2-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2C(F)(F)F)c2ncccc12)C(=O)O |
| InChI | InChI=1S/C18H10F3N3O2/c19-18(20,21)14-5-1-2-6-15(14)24-10-12(8-11(9-22)17(25)26)13-4-3-7-23-16(13)24/h1-8,10H,(H,25,26)/b11-8+ |
| InChIKey | PJHBJAUFFWEUIK-DHZHZOJOSA-N |
| XLogP | 4.04 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|