C10H16F3N — CID 168972551
N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine (PubChem CID 168972551) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine.
| Compound Name | N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine |
|---|---|
| PubChem CID | 168972551 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine |
| SMILES | CC/C=C(\N=C(/C)CCC)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c1-4-6-8(3)14-9(7-5-2)10(11,12)13/h7H,4-6H2,1-3H3/b9-7-,14-8+ |
| InChIKey | VZZXANFLRMCGPG-JIAHQVGESA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|