About N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine
N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine (PubChem CID 168972551) has the molecular formula C10H16F3N
and a molecular weight of 207.24 g/mol. Its IUPAC name is N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine.
Molecular Properties
| Compound Name | N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine |
| PubChem CID | 168972551 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine |
| SMILES | CC/C=C(\N=C(/C)CCC)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c1-4-6-8(3)14-9(7-5-2)10(11,12)13/h7H,4-6H2,1-3H3/b9-7-,14-8+ |
| InChIKey | VZZXANFLRMCGPG-JIAHQVGESA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine?
The IUPAC name of N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine (CID 168972551) is N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine.
What is the SMILES notation for N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine?
The canonical SMILES for N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine is CC/C=C(\N=C(/C)CCC)C(F)(F)F.
What is the InChIKey of N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine?
The InChIKey is VZZXANFLRMCGPG-JIAHQVGESA-N. The full InChI is InChI=1S/C10H16F3N/c1-4-6-8(3)14-9(7-5-2)10(11,12)13/h7H,4-6H2,1-3H3/b9-7-,14-8+.
What are the key properties of N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine?
N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine has a molecular weight of 207.24 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pentan-2-imine is sourced from PubChem (CID 168972551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).