C57H107N3O6 — CID 168975999
[7-(butylamino)-6-[3-(dimethylamino)propyl-(6-heptadecan-9-yloxy-6-oxohexanoyl)amino]-7-oxoheptyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 168975999) has the molecular formula C57H107N3O6 and a molecular weight of 930.50 g/mol. Its IUPAC name is [7-(butylamino)-6-[3-(dimethylamino)propyl-(6-heptadecan-9-yloxy-6-oxohexanoyl)amino]-7-oxoheptyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [7-(butylamino)-6-[3-(dimethylamino)propyl-(6-heptadecan-9-yloxy-6-oxohexanoyl)amino]-7-oxoheptyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 168975999 |
| Molecular Formula | C57H107N3O6 |
| Molecular Weight | 930.50 g/mol |
| Exact Mass | 929.82 |
| IUPAC Name | [7-(butylamino)-6-[3-(dimethylamino)propyl-(6-heptadecan-9-yloxy-6-oxohexanoyl)amino]-7-oxoheptyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCCC(C(=O)NCCCC)N(CCCN(C)C)C(=O)CCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C57H107N3O6/c1-7-11-15-18-21-22-23-24-25-26-27-28-29-32-37-46-55(62)65-51-40-33-36-44-53(57(64)58-48-14-10-4)60(50-41-49-59(5)6)54(61)45-38-39-47-56(63)66-52(42-34-30-19-16-12-8-2)43-35-31-20-17-13-9-3/h21-22,24-25,52-53H,7-20,23,26-51H2,1-6H3,(H,58,64)/b22-21-,25-24- |
| InChIKey | NHIGELPTHCIBHZ-HLEFPVAISA-N |
| XLogP | 14.94 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.50 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|