C11H20N2S — CID 168983767
4-buta-1,3-dien-2-yl-1,2-dimethyl-1,4-diazepane-5-thiol (PubChem CID 168983767) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-1,2-dimethyl-1,4-diazepane-5-thiol.
| Compound Name | 4-buta-1,3-dien-2-yl-1,2-dimethyl-1,4-diazepane-5-thiol |
|---|---|
| PubChem CID | 168983767 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-1,2-dimethyl-1,4-diazepane-5-thiol |
| SMILES | C=CC(=C)N1CC(C)N(C)CCC1S |
| InChI | InChI=1S/C11H20N2S/c1-5-9(2)13-8-10(3)12(4)7-6-11(13)14/h5,10-11,14H,1-2,6-8H2,3-4H3 |
| InChIKey | PULZIQJSFJYLPH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|