C10H10N5O2S2Zn-3 — CID 168986210
2-aminoethylazanide;6-nitroquinoxaline-2,3-dithiolate;zinc (PubChem CID 168986210) has the molecular formula C10H10N5O2S2Zn-3 and a molecular weight of 361.75 g/mol. Its IUPAC name is 2-aminoethylazanide;6-nitroquinoxaline-2,3-dithiolate;zinc.
| Compound Name | 2-aminoethylazanide;6-nitroquinoxaline-2,3-dithiolate;zinc |
|---|---|
| PubChem CID | 168986210 |
| Molecular Formula | C10H10N5O2S2Zn-3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 2-aminoethylazanide;6-nitroquinoxaline-2,3-dithiolate;zinc |
| SMILES | O=[N+]([O-])c1ccc2nc([S-])c([S-])nc2c1.[NH-]CCN.[Zn] |
| InChI | InChI=1S/C8H5N3O2S2.C2H7N2.Zn/c12-11(13)4-1-2-5-6(3-4)10-8(15)7(14)9-5;3-1-2-4;/h1-3H,(H,9,14)(H,10,15);3H,1-2,4H2;/q;-1;/p-2 |
| InChIKey | XKKMMPDBHAIYCD-UHFFFAOYSA-L |
| XLogP | 1.34 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|