C24H36NO2+ — CID 169001077
[(2R,4S)-9b-ethenyl-4-hydroxy-3,5a,9a-trimethyl-2-(6-methyl-2-pyridinyl)-2,3a,4,5,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-3-yl]oxidanium (PubChem CID 169001077) has the molecular formula C24H36NO2+ and a molecular weight of 370.56 g/mol. Its IUPAC name is [(2R,4S)-9b-ethenyl-4-hydroxy-3,5a,9a-trimethyl-2-(6-methyl-2-pyridinyl)-2,3a,4,5,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-3-yl]oxidanium.
| Compound Name | [(2R,4S)-9b-ethenyl-4-hydroxy-3,5a,9a-trimethyl-2-(6-methyl-2-pyridinyl)-2,3a,4,5,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-3-yl]oxidanium |
|---|---|
| PubChem CID | 169001077 |
| Molecular Formula | C24H36NO2+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [(2R,4S)-9b-ethenyl-4-hydroxy-3,5a,9a-trimethyl-2-(6-methyl-2-pyridinyl)-2,3a,4,5,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-3-yl]oxidanium |
| SMILES | C=CC12C[C@H](c3cccc(C)n3)C(C)([OH2+])C1C(O)CC1(C)CCCCC12C |
| InChI | InChI=1S/C24H35NO2/c1-6-24-14-17(18-11-9-10-16(2)25-18)23(5,27)20(24)19(26)15-21(3)12-7-8-13-22(21,24)4/h6,9-11,17,19-20,26-27H,1,7-8,12-15H2,2-5H3/p+1/t17-,19?,20?,21?,22?,23?,24?/m1/s1 |
| InChIKey | DPJFPPOEVBIZCV-PHFCSJPGSA-O |
| XLogP | 4.50 |
| TPSA | 56.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|