C9H11O7P — CID 169009573
4-ethenyl-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one (PubChem CID 169009573) has the molecular formula C9H11O7P and a molecular weight of 262.15 g/mol. Its IUPAC name is 4-ethenyl-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-ethenyl-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 169009573 |
| Molecular Formula | C9H11O7P |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 4-ethenyl-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one |
| SMILES | C=CC1OC(=O)OC1/C=C/OP1(=O)OCCO1 |
| InChI | InChI=1S/C9H11O7P/c1-2-7-8(16-9(10)15-7)3-4-12-17(11)13-5-6-14-17/h2-4,7-8H,1,5-6H2/b4-3+ |
| InChIKey | ZHVQUTVRLTZIAU-ONEGZZNKSA-N |
| XLogP | 1.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|